ChemNet > CAS > 9011-11-4 poli (stiren-ko-alfa-metilstiren)
9011-11-4 poli (stiren-ko-alfa-metilstiren)
| ürün Ad? |
poli (stiren-ko-alfa-metilstiren) |
| E? anlaml? |
Benzen, etenil-, (1-metiletenil)benzenli polimer; Etenilbenzen, (1-metiletenil)benzen ile kopolimer; etenilbenzen - prop-1-en-2-ilbenzen (1:1);
|
| ingilizce ad? |
poly(styrene-co-alpha-methylstyrene);Benzene, ethenyl-, polymer with (1-methylethenyl)benzene; Ethenylbenzene, copolymer with (1-methylethenyl)benzene; ethenylbenzene - prop-1-en-2-ylbenzene (1:1) |
| Moleküler Formülü |
C17H18 |
| Molekül A??rl??? |
222.3248 |
| InChI |
InChI=1/C9H10.C8H8/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2 |
| CAS kay?t numaras? |
9011-11-4 |
| Moleküler Yap?s? |
|
| Kaynama noktas? |
162.5°C at 760 mmHg |
| Alevlenme noktas? |
45.6°C |
| Buhar bas?nc? |
2.83mmHg at 25°C |
|