| ürün Ad? |
Klorfenak |
| E? anlaml? |
; 2,3,6-Triklorofenilasetik asit; Klorfenak [BSI:ISO]; 2,3,6-Say??tay; 2,3,6-Triklorobenzenasetik asit; 2,3,6-Triklorofenil asetik asit; 2,3,6-Triklorfenilessigsaeure; 2,3,6-Trichlorphenylessigsaeure [Almanca]; 4-09-00-01681 (Beilstein El Kitab? Referans?); Asetik asit, (2,3,6-triklorofenil)-; BRN 2113332; Benzenasetik asit, 2,3,6-trikloro-; Caswell Hay?r.882; EINECS 201-599-3; EPA Pestisit Kimyasal Kodu 082601; Fenak; Fenae; Fenatrol; HSDB 3434; Kanepar; Kyselina 2,3,6-triklorfenilokto; Kyselina 2,3,6-triklorfeniloktova [?ek]; NSC 41931; ü?lü fene; ü?lü; Trifen; (2,3,6-triklorofenil)asetat;
|
| ingilizce ad? |
Chlorfenac; 2,3,6-Trichlorophenylacetic acid; Chlorfenac [BSI:ISO]; 2,3,6-TCA; 2,3,6-Trichlorobenzeneacetic acid; 2,3,6-Trichlorophenyl acetic acid; 2,3,6-Trichlorphenylessigsaeure; 2,3,6-Trichlorphenylessigsaeure [German]; 4-09-00-01681 (Beilstein Handbook Reference); Acetic acid, (2,3,6-trichlorophenyl)-; BRN 2113332; Benzeneacetic acid, 2,3,6-trichloro-; Caswell No. 882; EINECS 201-599-3; EPA Pesticide Chemical Code 082601; Fenac; Fenae; Fenatrol; HSDB 3434; Kanepar; Kyselina 2,3,6-trichlorfenyloctova; Kyselina 2,3,6-trichlorfenyloctova [Czech]; NSC 41931; Tri fene; Tri-fen; Trifene; (2,3,6-trichlorophenyl)acetate |
| Moleküler Formülü |
C8H4Cl3O2 |
| Molekül A??rl??? |
238.4757 |
| InChI |
InChI=1/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13)/p-1 |
| CAS kay?t numaras? |
85-34-7 |
| EINECS |
201-599-3 |
| Moleküler Yap?s? |
|
| Kaynama noktas? |
353.5°C at 760 mmHg |
| Alevlenme noktas? |
167.6°C |
| Buhar bas?nc? |
1.32E-05mmHg at 25°C |
| Risk Kodlar? |
R22:Harmful if swallowed.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Güvenlik A??klamas? |
S36:Wear suitable protective clothing.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|