813-56-9 Malonik-d2 asit-d2
| ürün Ad? |
Malonik-d2 asit-d2 |
| E? anlaml? |
; Malonik asit-d4; (~2~H_2_)propan (~2~H_2_)dioik asit;
|
| ingilizce ad? |
Malonic-d2 acid-d2; Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
| Moleküler Formülü |
C3D4O4 |
| Molekül A??rl??? |
108.0861 |
| InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| CAS kay?t numaras? |
813-56-9 |
| EINECS |
212-385-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.605g/cm3 |
| Ergime noktas? |
130-132℃ |
| Kaynama noktas? |
386.8°C at 760 mmHg |
| K?r?lma indisi |
1.478 |
| Alevlenme noktas? |
201.9°C |
| Buhar bas?nc? |
4.66E-07mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|