ChemNet > CAS > 75-39-8 Asetaldehit amonyak trimeri
75-39-8 Asetaldehit amonyak trimeri
| ürün Ad? |
Asetaldehit amonyak trimeri |
| E? anlaml? |
; Heksahidro-2,4,6-trimetil-s-triazin trihidrat; Asetaldehit amonyak trimeri,; Asetaldehit-Amonyak; 1-aminoetanol; asetaldehit amonyak (1:1);
|
| ingilizce ad? |
Acetaldehyde ammonia trimer; Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| Moleküler Formülü |
C2H7NO |
| Molekül A??rl??? |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| CAS kay?t numaras? |
75-39-8 |
| EINECS |
200-868-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.967g/cm3 |
| Ergime noktas? |
95-97℃ |
| Kaynama noktas? |
113.8°C at 760 mmHg |
| K?r?lma indisi |
1.431 |
| Alevlenme noktas? |
22.7°C |
| Buhar bas?nc? |
10.4mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|