ChemNet > CAS > 4265-57-0 Metilenbis (3-tiyopropiyonik asit)
4265-57-0 Metilenbis (3-tiyopropiyonik asit)
| ürün Ad? |
Metilenbis (3-tiyopropiyonik asit) |
| E? anlaml? |
3,3'-(Metilenebis(tiyo))bispropiyonik asit
|
| ingilizce ad? |
Methylenebis(3-thiopropionic acid);3,3'-(Methylenebis(thio))bispropionic acid |
| Moleküler Formülü |
C7H12O4S2 |
| Molekül A??rl??? |
224.2978 |
| InChI |
InChI=1/C7H12O4S2/c8-6(9)4(2-12)1-5(3-13)7(10)11/h4-5,12-13H,1-3H2,(H,8,9)(H,10,11) |
| CAS kay?t numaras? |
4265-57-0 |
| EINECS |
224-251-2 |
| Moleküler Yap?s? |
|
| K?r?lma indisi |
1.571 |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|