| ürün Ad? |
Fenil laurat |
| E? anlaml? |
;D odekanoik asit fenil ester ~ Fenil dodekanoat; fenil dodekanoat;
|
| ingilizce ad? |
Phenyl laurate; Dodecanoic acid phenyl ester~Phenyl dodecanoate; phenyl dodecanoate |
| Moleküler Formülü |
C18H28O2 |
| Molekül A??rl??? |
276.4137 |
| InChI |
InChI=1/C18H28O2/c1-2-3-4-5-6-7-8-9-13-16-18(19)20-17-14-11-10-12-15-17/h10-12,14-15H,2-9,13,16H2,1H3 |
| CAS kay?t numaras? |
4228-00-6 |
| EINECS |
224-178-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.946g/cm3 |
| Kaynama noktas? |
366.5°C at 760 mmHg |
| K?r?lma indisi |
1.486 |
| Alevlenme noktas? |
123.9°C |
| Buhar bas?nc? |
1.46E-05mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|