3404-61-3 3-Metil-1-heksen
| ürün Ad? |
3-Metil-1-heksen |
| E? anlaml? |
; 1-heksen, 3-metil-; 222-283-1; 3-metilhex-1-en;
|
| ingilizce ad? |
3-Methyl-1-hexene; 1-hexene, 3-methyl-; 222-283-1; 3-methylhex-1-ene |
| Moleküler Formülü |
C7H14 |
| Molekül A??rl??? |
98.1861 |
| InChI |
InChI=1/C7H14/c1-4-6-7(3)5-2/h5,7H,2,4,6H2,1,3H3 |
| CAS kay?t numaras? |
3404-61-3 |
| EINECS |
222-283-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.703g/cm3 |
| Kaynama noktas? |
85.4°C at 760 mmHg |
| K?r?lma indisi |
1.404 |
| Buhar bas?nc? |
77.8mmHg at 25°C |
| Tehlike Sembolleri |
F:Highly flammable;
Xi:Irritant;
|
| Risk Kodlar? |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|