324-42-5 2-floro-6-metilnaftalin
| ürün Ad? |
2-floro-6-metilnaftalin |
| E? anlaml? |
|
| ingilizce ad? |
2-fluoro-6-methylnaphthalene; |
| Moleküler Formülü |
C11H9F |
| Molekül A??rl??? |
160.1876 |
| InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
| CAS kay?t numaras? |
324-42-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.112g/cm3 |
| Ergime noktas? |
72℃ |
| Kaynama noktas? |
247.5°C at 760 mmHg |
| K?r?lma indisi |
1.594 |
| Alevlenme noktas? |
84.5°C |
| Buhar bas?nc? |
0.0403mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|