1066-38-2 Trimetiliyodogerman
| ürün Ad? |
Trimetiliyodogerman |
| E? anlaml? |
; Trimetilgermanyum iyodür; ?yodotrimetilgerman; trimetilgermanyli iyodür;
|
| ingilizce ad? |
Trimethyliodogermane; Trimethylgermanium iodide; Iodotrimethylgermane; trimethylgermanylium iodide |
| Moleküler Formülü |
C3H9GeI |
| Molekül A??rl??? |
244.648 |
| InChI |
InChI=1/C3H9Ge.HI/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| CAS kay?t numaras? |
1066-38-2 |
| Moleküler Yap?s? |
|
| Tehlike Sembolleri |
T:Toxic;
|
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
R61:May cause harm to the unborn child.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|