ChemNet > CAS > 930-61-0 2?4-????? ????? -2-??????????? ? 1H-????????? ? 4?5-????? ?????-2?5-????? ?????- ? 1H-????????? ? 4?5-????? ?????-2?4-????? ?????- ? 4?5-???????-2?4-????? ????? -1H-????????? ? 2?5-????? ????? -4?5-???????-1H-????????? ?
930-61-0 2?4-????? ????? -2-??????????? ? 1H-????????? ? 4?5-????? ?????-2?5-????? ?????- ? 1H-????????? ? 4?5-????? ?????-2?4-????? ?????- ? 4?5-???????-2?4-????? ????? -1H-????????? ? 2?5-????? ????? -4?5-???????-1H-????????? ?
| ??? ?????? |
2?4-????? ????? -2-??????????? ? 1H-????????? ? 4?5-????? ?????-2?5-????? ?????- ? 1H-????????? ? 4?5-????? ?????-2?4-????? ?????- ? 4?5-???????-2?4-????? ????? -1H-????????? ? 2?5-????? ????? -4?5-???????-1H-????????? ? |
| ????? ??????????? |
2,4-Dimethyl-2-imidazoline;1H-Imidazole, 4,5-dihydro-2,5-dimethyl-; 1H-Imidazole, 4,5-dihydro-2,4-dimethyl-; 4,5-Dihydro-2,4-dimethyl-1H-imidazole; 2,5-dimethyl-4,5-dihydro-1H-imidazole |
| ?????? ???????? |
C5H10N2 |
| ????? ??????? ??????? |
98.1463 |
| InChI |
InChI=1/C5H10N2/c1-4-3-6-5(2)7-4/h4H,3H2,1-2H3,(H,6,7) |
| ?????????? ???????? ??????? |
930-61-0 |
| ???????? ????????? ??? |
213-220-9 |
| ???? ?????? |
|
| ????? |
1.07g/cm3 |
| ???? ??????? |
198.6°C at 760 mmHg |
| ????? ???????? |
1.54 |
| ???? ?????? |
73.9°C |
| ??? ?????? |
0.504mmHg at 25°C |
| ??? ????????? |
R36/38:Irritating to eyes and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|