ChemNet > CAS > 75-39-8 ????????????? ???????? ?????????. ??????????-2?4?6-????? ?????-?-??????? ????? ??????. ????????????? ???????? ??????????? ????????????? ????????. 1-????????????. ??????????? ????????? (1: 1) ?
75-39-8 ????????????? ???????? ?????????. ??????????-2?4?6-????? ?????-?-??????? ????? ??????. ????????????? ???????? ??????????? ????????????? ????????. 1-????????????. ??????????? ????????? (1: 1) ?
| ??? ?????? |
????????????? ???????? ?????????. ??????????-2?4?6-????? ?????-?-??????? ????? ??????. ????????????? ???????? ??????????? ????????????? ????????. 1-????????????. ??????????? ????????? (1: 1) ? |
| ????? ??????????? |
Acetaldehyde ammonia trimer; Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| ?????? ???????? |
C2H7NO |
| ????? ??????? ??????? |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| ?????????? ???????? ??????? |
75-39-8 |
| ???????? ????????? ??? |
200-868-2 |
| ???? ?????? |
|
| ????? |
0.967g/cm3 |
| ???? ???????? |
95-97℃ |
| ???? ??????? |
113.8°C at 760 mmHg |
| ????? ???????? |
1.431 |
| ???? ?????? |
22.7°C |
| ??? ?????? |
10.4mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|