ChemNet > CAS > 5142-22-3 1-????? ??????. 6H-??????-6-????? ? 1?9-???????-1-?????- ? ???????? ? 1-?????- ? ???? ????? ?????? 70896 ? 1-?????-1H-??????-6-????. 1H-??????-6-???? ? 1-?????- (9CI) ? 1-?????-1?7-???????-6H-?????-6-????? ?
5142-22-3 1-????? ??????. 6H-??????-6-????? ? 1?9-???????-1-?????- ? ???????? ? 1-?????- ? ???? ????? ?????? 70896 ? 1-?????-1H-??????-6-????. 1H-??????-6-???? ? 1-?????- (9CI) ? 1-?????-1?7-???????-6H-?????-6-????? ?
| ??? ?????? |
1-????? ??????. 6H-??????-6-????? ? 1?9-???????-1-?????- ? ???????? ? 1-?????- ? ???? ????? ?????? 70896 ? 1-?????-1H-??????-6-????. 1H-??????-6-???? ? 1-?????- (9CI) ? 1-?????-1?7-???????-6H-?????-6-????? ? |
| ????? ??????????? |
1-Methyladenine;6H-Purin-6-imine, 1,9-dihydro-1-methyl-; Adenine, 1-methyl-; NSC 70896; 1-Methyl-1H-purin-6-amine; 1H-Purin-6-amine, 1-methyl- (9CI); 1-methyl-1,7-dihydro-6H-purin-6-imine |
| ?????? ???????? |
C6H7N5 |
| ????? ??????? ??????? |
149.1533 |
| InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(5(11)7)8-2-9-6/h2-3,7H,1H3,(H,8,9) |
| ?????????? ???????? ??????? |
5142-22-3 |
| ???????? ????????? ??? |
225-907-0 |
| ???? ?????? |
|
| ????? |
1.607g/cm3 |
| ???? ???????? |
300℃ |
| ???? ??????? |
415.879°C at 760 mmHg |
| ????? ???????? |
1.807 |
| ???? ?????? |
205.317°C |
| ??? ?????? |
0mmHg at 25°C |
| ???? ????? |
S24/25:Avoid contact with skin and eyes.;
|
|