ChemNet > CAS > 324-42-5 2-?????-6-????? ??????? ?
324-42-5 2-?????-6-????? ??????? ?
| ??? ?????? |
2-?????-6-????? ??????? ? |
| ????? ??????????? |
2-fluoro-6-methylnaphthalene; |
| ?????? ???????? |
C11H9F |
| ????? ??????? ??????? |
160.1876 |
| InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
| ?????????? ???????? ??????? |
324-42-5 |
| ???? ?????? |
|
| ????? |
1.112g/cm3 |
| ???? ???????? |
72℃ |
| ???? ??????? |
247.5°C at 760 mmHg |
| ????? ???????? |
1.594 |
| ???? ?????? |
84.5°C |
| ??? ?????? |
0.0403mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|