ChemNet > CAS > 9011-11-4 poli(estireno-co-alfa-metilestireno)
9011-11-4 poli(estireno-co-alfa-metilestireno)
| Nome do produto |
poli(estireno-co-alfa-metilestireno) |
| Sin?nimos |
Benzeno, etenil-, polímero com (1-metiletenil)benzeno; Etenilbenzeno, copolímero com (1-metiletenil)benzeno; etenilbenzeno - prop-1-en-2-ilbenzeno (1:1) |
| Nome em inglês |
poly(styrene-co-alpha-methylstyrene);Benzene, ethenyl-, polymer with (1-methylethenyl)benzene; Ethenylbenzene, copolymer with (1-methylethenyl)benzene; ethenylbenzene - prop-1-en-2-ylbenzene (1:1) |
| Fórmula molecular |
C17H18 |
| Peso Molecular |
222.3248 |
| InChI |
InChI=1/C9H10.C8H8/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2 |
| CAS Registry Number |
9011-11-4 |
| Estrutura Molecular |
|
| Ponto de ebuli??o |
162.5°C at 760 mmHg |
| O ponto de inflama??o |
45.6°C |
| Press?o de vapor |
2.83mmHg at 25°C |
|