ChemNet > CAS > 4265-57-0 Metilenobis(ácido 3-tiopropi?nico)
4265-57-0 Metilenobis(ácido 3-tiopropi?nico)
| Nome do produto |
Metilenobis(ácido 3-tiopropi?nico) |
| Sin?nimos |
ácido bispropi?nico 3,3'-(metilenobis(tio))) |
| Nome em inglês |
Methylenebis(3-thiopropionic acid);3,3'-(Methylenebis(thio))bispropionic acid |
| Fórmula molecular |
C7H12O4S2 |
| Peso Molecular |
224.2978 |
| InChI |
InChI=1/C7H12O4S2/c8-6(9)4(2-12)1-5(3-13)7(10)11/h4-5,12-13H,1-3H2,(H,8,9)(H,10,11) |
| CAS Registry Number |
4265-57-0 |
| EINECS |
224-251-2 |
| Estrutura Molecular |
|
| índice de refra??o |
1.571 |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|