ChemNet > CAS > 9011-11-4 poli(styren-ko-alfa-metylostyren)
9011-11-4 poli(styren-ko-alfa-metylostyren)
| Nazwa produktu: |
poli(styren-ko-alfa-metylostyren) |
| Synonimy |
Benzen, etenylo-, polimer z (1-metyloeantenylo)benzenem; Etenylobenzen, kopolimer z (1-metyloetylenylo)benzenem; etenylobenzen - prop-1-en-2-ylobenzen (1:1) |
| Angielska nazwa |
poly(styrene-co-alpha-methylstyrene);Benzene, ethenyl-, polymer with (1-methylethenyl)benzene; Ethenylbenzene, copolymer with (1-methylethenyl)benzene; ethenylbenzene - prop-1-en-2-ylbenzene (1:1) |
| MF |
C17H18 |
| Masie cz?steczkowej |
222.3248 |
| InChI |
InChI=1/C9H10.C8H8/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2 |
| Nr CAS |
9011-11-4 |
| Struktury molekularnej |
|
| Temperatura wrzenia |
162.5°C at 760 mmHg |
| Temperatura zap?onu |
45.6°C |
| Ci?nienie pary |
2.83mmHg at 25°C |
|