ChemNet > CAS > 4265-57-0 metylenobis(kwas 3-tiopropionowy)
4265-57-0 metylenobis(kwas 3-tiopropionowy)
| Nazwa produktu: |
metylenobis(kwas 3-tiopropionowy) |
| Synonimy |
Kwas 3,3'-(metylenobis(tio))bispropionowy |
| Angielska nazwa |
Methylenebis(3-thiopropionic acid);3,3'-(Methylenebis(thio))bispropionic acid |
| MF |
C7H12O4S2 |
| Masie cz?steczkowej |
224.2978 |
| InChI |
InChI=1/C7H12O4S2/c8-6(9)4(2-12)1-5(3-13)7(10)11/h4-5,12-13H,1-3H2,(H,8,9)(H,10,11) |
| Nr CAS |
4265-57-0 |
| EINECS |
224-251-2 |
| Struktury molekularnej |
|
| Wspó?czynnik za?amania |
1.571 |
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|