ChemNet > CAS > 324-42-5 2-fluoro-6-metylonaftalen
324-42-5 2-fluoro-6-metylonaftalen
| Nazwa produktu: |
2-fluoro-6-metylonaftalen |
| Angielska nazwa |
2-fluoro-6-methylnaphthalene; |
| MF |
C11H9F |
| Masie cz?steczkowej |
160.1876 |
| InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
| Nr CAS |
324-42-5 |
| Struktury molekularnej |
|
| G?sto?? |
1.112g/cm3 |
| Temperatura topnienia |
72℃ |
| Temperatura wrzenia |
247.5°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.594 |
| Temperatura zap?onu |
84.5°C |
| Ci?nienie pary |
0.0403mmHg at 25°C |
| Symbole zagro?enia |
Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|