813-56-9 Malonic-d2 syre-d2
| produktnavn |
Malonic-d2 syre-d2 |
| Synonymer |
; Malonsyre-d4; (~2~H_2_)propan (~2~H_2_)diosyre |
| Engelsk navn |
Malonic-d2 acid-d2; Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
| Molekyl?r Formel |
C3D4O4 |
| Molekylvekt |
108.0861 |
| InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| CAS-nummer |
813-56-9 |
| EINECS |
212-385-4 |
| Molecular Structure |
|
| Tetthet |
1.605g/cm3 |
| Smeltepunkt |
130-132℃ |
| Kokepunkt |
386.8°C at 760 mmHg |
| Brytningsindeks |
1.478 |
| Flammepunktet |
201.9°C |
| Damptrykk |
4.66E-07mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|