ChemNet > CAS > 4265-57-0 metylenbis(3-tiopropionsyre)
4265-57-0 metylenbis(3-tiopropionsyre)
| produktnavn |
metylenbis(3-tiopropionsyre) |
| Synonymer |
3,3'-(metylenbis(tio))bispropionsyre |
| Engelsk navn |
Methylenebis(3-thiopropionic acid);3,3'-(Methylenebis(thio))bispropionic acid |
| Molekyl?r Formel |
C7H12O4S2 |
| Molekylvekt |
224.2978 |
| InChI |
InChI=1/C7H12O4S2/c8-6(9)4(2-12)1-5(3-13)7(10)11/h4-5,12-13H,1-3H2,(H,8,9)(H,10,11) |
| CAS-nummer |
4265-57-0 |
| EINECS |
224-251-2 |
| Molecular Structure |
|
| Brytningsindeks |
1.571 |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|