3404-61-3 3-metyl-1-heksen
| produktnavn |
3-metyl-1-heksen |
| Synonymer |
; 1-heksen, 3-metyl-; 222-283-1; 3-metylhex-1-en |
| Engelsk navn |
3-Methyl-1-hexene; 1-hexene, 3-methyl-; 222-283-1; 3-methylhex-1-ene |
| Molekyl?r Formel |
C7H14 |
| Molekylvekt |
98.1861 |
| InChI |
InChI=1/C7H14/c1-4-6-7(3)5-2/h5,7H,2,4,6H2,1,3H3 |
| CAS-nummer |
3404-61-3 |
| EINECS |
222-283-1 |
| Molecular Structure |
|
| Tetthet |
0.703g/cm3 |
| Kokepunkt |
85.4°C at 760 mmHg |
| Brytningsindeks |
1.404 |
| Damptrykk |
77.8mmHg at 25°C |
| Hazard symboler |
F:Highly flammable;
Xi:Irritant;
|
| Risiko Koder |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|