| Naam product |
2,4-dimethyl-2-imidazoline |
| Synoniemen |
1H-imidazool, 4,5-dihydro-2,5-dimethyl-; 1H-imidazool, 4,5-dihydro-2,4-dimethyl-; 4,5-dihydro-2,4-dimethyl-1H-imidazool; 2,5-dimethyl-4,5-dihydro-1H-imidazool |
| Engelse naam |
2,4-Dimethyl-2-imidazoline;1H-Imidazole, 4,5-dihydro-2,5-dimethyl-; 1H-Imidazole, 4,5-dihydro-2,4-dimethyl-; 4,5-Dihydro-2,4-dimethyl-1H-imidazole; 2,5-dimethyl-4,5-dihydro-1H-imidazole |
| MF |
C5H10N2 |
| Molecuulgewicht |
98.1463 |
| InChI |
InChI=1/C5H10N2/c1-4-3-6-5(2)7-4/h4H,3H2,1-2H3,(H,6,7) |
| CAS-nummer |
930-61-0 |
| EINECS |
213-220-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.07g/cm3 |
| Kookpunt |
198.6°C at 760 mmHg |
| Brekingsindex |
1.54 |
| Vlampunt |
73.9°C |
| Dampdruk |
0.504mmHg at 25°C |
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|