9003-42-3 Poly(ethylmethacrylaat)
| Naam product |
Poly(ethylmethacrylaat) |
| Synoniemen |
Ethylmethacrylaathars; ethyl-2-methylprop-2-enoaat |
| Engelse naam |
Poly(ethyl methacrylate); Ethyl Methacrylate Resin; ethyl 2-methylprop-2-enoate |
| MF |
C6H10O2 |
| Molecuulgewicht |
114.1424 |
| InChI |
InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
| CAS-nummer |
9003-42-3 |
| EINECS |
202-597-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.906g/cm3 |
| Kookpunt |
120.5°C at 760 mmHg |
| Brekingsindex |
1.409 |
| Vlampunt |
15.6°C |
| Dampdruk |
15.2mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|