ChemNet > CAS > 75-39-8 Aceetaldehyde ammoniak trimeer
75-39-8 Aceetaldehyde ammoniak trimeer
| Naam product |
Aceetaldehyde ammoniak trimeer |
| Synoniemen |
hexahydro-2,4,6-trimethyl-s-triazinetrihydraat; Aceetaldehyde ammoniak trimeer,; aceetaldehyde-ammoniak; 1-aminoethanol; aceetaldehyde ammoniak (1:1) |
| Engelse naam |
Acetaldehyde ammonia trimer; Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| MF |
C2H7NO |
| Molecuulgewicht |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| CAS-nummer |
75-39-8 |
| EINECS |
200-868-2 |
| Moleculaire Structuur |
|
| Dichtheid |
0.967g/cm3 |
| Smeltpunt |
95-97℃ |
| Kookpunt |
113.8°C at 760 mmHg |
| Brekingsindex |
1.431 |
| Vlampunt |
22.7°C |
| Dampdruk |
10.4mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|