614-34-6 P-tolylbenzoaat
| Naam product |
P-tolylbenzoaat |
| Synoniemen |
;p-tolylbenzoaat (benzo?zuur p-tolylester); Benzo?zuur p-tolylester; 4-methylfenylbenzoaat |
| Engelse naam |
P-tolyl benzoate; p-Tolyl benzoate (Benzoic acid p-tolyl ester); Benzoic acid p-tolyl ester; 4-methylphenyl benzoate |
| MF |
C14H12O2 |
| Molecuulgewicht |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
| CAS-nummer |
614-34-6 |
| EINECS |
210-380-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.122g/cm3 |
| Smeltpunt |
70-72℃ |
| Kookpunt |
316.6°C at 760 mmHg |
| Brekingsindex |
1.577 |
| Vlampunt |
130.1°C |
| Dampdruk |
0.000407mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|