5142-22-3 1-methyladenine
| Naam product |
1-methyladenine |
| Synoniemen |
6H-Purin-6-imine, 1,9-dihydro-1-methyl-; Adenine, 1-methyl-; NSC 70896; 1-methyl-1H-purine-6-amine; 1H-Purin-6-amine, 1-methyl- (9CI); 1-methyl-1,7-dihydro-6H-purine-6-imine |
| Engelse naam |
1-Methyladenine;6H-Purin-6-imine, 1,9-dihydro-1-methyl-; Adenine, 1-methyl-; NSC 70896; 1-Methyl-1H-purin-6-amine; 1H-Purin-6-amine, 1-methyl- (9CI); 1-methyl-1,7-dihydro-6H-purin-6-imine |
| MF |
C6H7N5 |
| Molecuulgewicht |
149.1533 |
| InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(5(11)7)8-2-9-6/h2-3,7H,1H3,(H,8,9) |
| CAS-nummer |
5142-22-3 |
| EINECS |
225-907-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.607g/cm3 |
| Smeltpunt |
300℃ |
| Kookpunt |
415.879°C at 760 mmHg |
| Brekingsindex |
1.807 |
| Vlampunt |
205.317°C |
| Dampdruk |
0mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|