614-34-6 P-tolyl benzoate
| Nama produk |
P-tolyl benzoate |
| Sinonim |
;p-Tolyl benzoate (asid Benzoik p-tolyl ester); Asid benzoik p-tolyl ester; 4-methylphenyl benzoate |
| Nama Inggeris |
P-tolyl benzoate; p-Tolyl benzoate (Benzoic acid p-tolyl ester); Benzoic acid p-tolyl ester; 4-methylphenyl benzoate |
| MF |
C14H12O2 |
| Berat Molekul |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
| CAS NO |
614-34-6 |
| EINECS |
210-380-1 |
| Struktur Molekul |
|
| Kepadatan |
1.122g/cm3 |
| Titik lebur |
70-72℃ |
| Titik didih |
316.6°C at 760 mmHg |
| Indeks bias |
1.577 |
| Titik nyala |
130.1°C |
| Tekanan wap |
0.000407mmHg at 25°C |
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|