813-56-9 ??-d2 ?-d2
| ???? |
??-d2 ?-d2 |
| ?? |
; ???-d4; (~2~H_2_)???(~2~H_2_)??? |
| ?? ?? |
Malonic-d2 acid-d2; Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
| ??? |
C3D4O4 |
| ??? |
108.0861 |
| InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| cas?? |
813-56-9 |
| EC?? |
212-385-4 |
| ?? ?? |
|
| ?? |
1.605g/cm3 |
| ?? ? |
130-132℃ |
| ??? |
386.8°C at 760 mmHg |
| ?? ?? |
1.478 |
| ??? |
201.9°C |
| ??? |
4.66E-07mmHg at 25°C |
| ??? ?? |
Xn:Harmful;
|
| ??? ?? |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|