75-39-8 ??????? ???? ???
| ???? |
??????? ???? ??? |
| ?? |
; ?? ???? -2,4,6- ???? -s- ???? ?? ??????; ??? ???? ???? ???,; ???????-????; 1- ??? ???; ??????? ?????? (1:1) |
| ?? ?? |
Acetaldehyde ammonia trimer; Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| ??? |
C2H7NO |
| ??? |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| cas?? |
75-39-8 |
| EC?? |
200-868-2 |
| ?? ?? |
|
| ?? |
0.967g/cm3 |
| ?? ? |
95-97℃ |
| ??? |
113.8°C at 760 mmHg |
| ?? ?? |
1.431 |
| ??? |
22.7°C |
| ??? |
10.4mmHg at 25°C |
| ??? ?? |
Xi:Irritant;
|
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|