61-47-2 ???? ????? ???? ? ???
| ???? |
???? ????? ???? ? ??? |
| ?? |
; 5-????????? ????? ???? ????; 2- (2- ??? ??) ?? -5- ? 2- ??? -1- ?? ??? ?? -4- ? ???; 2- ??? -1- ?? -4- ?? -4,5- ? ???? -1H- ?? ?? -1- ?? ?? -1- ?? 2- (5- ?? ?? -1H- ?? -3- ?) ?? ??? ???? (1 : 1 : 1); 3- (2- ??? ??) -1H- ?? -5- ?; 2-???-1-??-5H-????-4-?; ??; ???; 2-(5-?????-1H-??-3-?)????? |
| ?? ?? |
Serotonin creatinine sulfate monohydrate; 5-Hydroxytryptamine creatinine sulfate monohydrate; 2-(2-aminoethyl)indole-5-ol 2-imino-1-methylimidazoline-4-one sulphate; 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazol-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminium sulfate (1:1:1); 3-(2-aminoethyl)-1H-indol-5-ol; 2-amino-1-methyl-5H-imidazol-4-one; sulfuric acid; hydrate; 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| ??? |
C10H13N2O |
| ??? |
177.2225 |
| InChI |
InChI=1/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| cas?? |
61-47-2 |
| EC?? |
213-539-3 |
| ?? ?? |
|
| ?? ? |
216-219℃ |
| ??? |
416.1°C at 760 mmHg |
| ??? |
205.4°C |
| ??? |
1.63E-07mmHg at 25°C |
| ??? ?? |
R40:Possible risks of irreversible effects.;
|
| ?? ?? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|