ChemNet > CAS > 9011-11-4 poli(stirene-co-alfa-metilstirene)
9011-11-4 poli(stirene-co-alfa-metilstirene)
| Nome del prodotto |
poli(stirene-co-alfa-metilstirene) |
| Sinonimi |
benzene, etenil-, polimero con (1-metiletenil)benzene; Etenilbenzene, copolimero con (1-metiletenil)benzene; etenilbenzene - prop-1-en-2-ilbenzene (1:1) |
| Nome inglese |
poly(styrene-co-alpha-methylstyrene);Benzene, ethenyl-, polymer with (1-methylethenyl)benzene; Ethenylbenzene, copolymer with (1-methylethenyl)benzene; ethenylbenzene - prop-1-en-2-ylbenzene (1:1) |
| Formula molecolare |
C17H18 |
| Peso Molecolare |
222.3248 |
| InChI |
InChI=1/C9H10.C8H8/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2 |
| Numero CAS |
9011-11-4 |
| Struttura molecolare |
|
| Punto di ebollizione |
162.5°C at 760 mmHg |
| Punto d'infiammabilità |
45.6°C |
| Pressione di vapore |
2.83mmHg at 25°C |
|