4567-98-0 dimetil undecanedioato
| Nome del prodotto |
dimetil undecanedioato |
| Sinonimi |
; 224-943-4; acido undecanedioico, estere dimetilico |
| Nome inglese |
dimethyl undecanedioate; 224-943-4; undecanedioic acid, dimethyl ester |
| Formula molecolare |
C13H24O4 |
| Peso Molecolare |
244.3273 |
| InChI |
InChI=1/C13H24O4/c1-16-12(14)10-8-6-4-3-5-7-9-11-13(15)17-2/h3-11H2,1-2H3 |
| Numero CAS |
4567-98-0 |
| EINECS |
224-943-4 |
| Struttura molecolare |
|
| Densità |
0.976g/cm3 |
| Punto di fusione |
17-19℃ |
| Punto di ebollizione |
287.7°C at 760 mmHg |
| Indice di rifrazione |
1.439 |
| Punto d'infiammabilità |
129.2°C |
| Pressione di vapore |
0.00244mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|