3404-61-3 3-metil-1-esene
| Nome del prodotto |
3-metil-1-esene |
| Sinonimi |
; 1-esene, 3-metil-; 222-283-1; 3-metiles-1-ene |
| Nome inglese |
3-Methyl-1-hexene; 1-hexene, 3-methyl-; 222-283-1; 3-methylhex-1-ene |
| Formula molecolare |
C7H14 |
| Peso Molecolare |
98.1861 |
| InChI |
InChI=1/C7H14/c1-4-6-7(3)5-2/h5,7H,2,4,6H2,1,3H3 |
| Numero CAS |
3404-61-3 |
| EINECS |
222-283-1 |
| Struttura molecolare |
|
| Densità |
0.703g/cm3 |
| Punto di ebollizione |
85.4°C at 760 mmHg |
| Indice di rifrazione |
1.404 |
| Pressione di vapore |
77.8mmHg at 25°C |
| Simboli di pericolo |
F:Highly flammable;
Xi:Irritant;
|
| Codici di Rischio |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|