ChemNet > CAS > 324-42-5 2-fluoro-6-metilnaftalene
324-42-5 2-fluoro-6-metilnaftalene
| Nome del prodotto |
2-fluoro-6-metilnaftalene |
| Nome inglese |
2-fluoro-6-methylnaphthalene; |
| Formula molecolare |
C11H9F |
| Peso Molecolare |
160.1876 |
| InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
| Numero CAS |
324-42-5 |
| Struttura molecolare |
|
| Densità |
1.112g/cm3 |
| Punto di fusione |
72℃ |
| Punto di ebollizione |
247.5°C at 760 mmHg |
| Indice di rifrazione |
1.594 |
| Punto d'infiammabilità |
84.5°C |
| Pressione di vapore |
0.0403mmHg at 25°C |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|