ChemNet > CAS > 92-29-5 ????????????? N? N'-Dibenzylidenetoluene-alpha? ???? ??????? NSC 1005? Methanediamine? 1-????-N? N'-bis (???? ?????)-? ?????? ????? ???? ??????? N? N'-dibenzylidene- (8CI)? N? N'-dibenzylidene-1-???? ??????????? 1-????-N? N'-bis [(E) -???? ???? ?????] ???? ???????
92-29-5 ????????????? N? N'-Dibenzylidenetoluene-alpha? ???? ??????? NSC 1005? Methanediamine? 1-????-N? N'-bis (???? ?????)-? ?????? ????? ???? ??????? N? N'-dibenzylidene- (8CI)? N? N'-dibenzylidene-1-???? ??????????? 1-????-N? N'-bis [(E) -???? ???? ?????] ???? ???????
| ??? ????? |
????????????? N? N'-Dibenzylidenetoluene-alpha? ???? ??????? NSC 1005? Methanediamine? 1-????-N? N'-bis (???? ?????)-? ?????? ????? ???? ??????? N? N'-dibenzylidene- (8CI)? N? N'-dibenzylidene-1-???? ??????????? 1-????-N? N'-bis [(E) -???? ???? ?????] ???? ??????? |
| ??? ??????? |
Hydrobenzamide;N,N'-Dibenzylidenetoluene-alpha,alpha-diamine; NSC 1005; Methanediamine, 1-phenyl-N,N'-bis(phenylmethylene)-; Toluene-alpha,alpha-diamine, N,N'-dibenzylidene- (8CI); N,N'-dibenzylidene-1-phenylmethanediamine; 1-phenyl-N,N'-bis[(E)-phenylmethylidene]methanediamine |
| ????? ???????? |
C21H18N2 |
| ??? ??????? |
298.381 |
| InChI |
InChI=1/C21H18N2/c1-4-10-18(11-5-1)16-22-21(20-14-8-3-9-15-20)23-17-19-12-6-2-7-13-19/h1-17,21H/b22-16+,23-17+ |
| ????? ?????? |
92-29-5 |
| ????? ??????? ??????? |
202-144-1 |
| ?????? ??????? |
|
| ????? |
1.013g/cm3 |
| ???? ????? |
422.606°C at 760 mmHg |
| ???? ???? |
1.578 |
| ???? ?????? |
201.987°C |
| ???? ???? |
0mmHg at 25°C |
| ??????? ????? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|