ChemNet > CAS > 75-39-8 ????????? ??????? trimer? ? Hexahydro-2?4?6-trimethyl-s-triazine trihydrate? ????????? ??????? trimer?? ????????? ???????? 1-????? ??????? ??????? ????????? (1:1)?
75-39-8 ????????? ??????? trimer? ? Hexahydro-2?4?6-trimethyl-s-triazine trihydrate? ????????? ??????? trimer?? ????????? ???????? 1-????? ??????? ??????? ????????? (1:1)?
| ??? ????? |
????????? ??????? trimer? ? Hexahydro-2?4?6-trimethyl-s-triazine trihydrate? ????????? ??????? trimer?? ????????? ???????? 1-????? ??????? ??????? ????????? (1:1)? |
| ??? ??????? |
Acetaldehyde ammonia trimer; Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| ????? ???????? |
C2H7NO |
| ??? ??????? |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| ????? ?????? |
75-39-8 |
| ????? ??????? ??????? |
200-868-2 |
| ?????? ??????? |
|
| ????? |
0.967g/cm3 |
| ???? ??? |
95-97℃ |
| ???? ????? |
113.8°C at 760 mmHg |
| ???? ???? |
1.431 |
| ???? ?????? |
22.7°C |
| ???? ???? |
10.4mmHg at 25°C |
| ??? ?????? |
Xi:Irritant;
|
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|