ChemNet > CAS > 61-47-2 ???????? ???????? ?????? ??????????? ? 5-???????? ????????? ???????? ?????? ??????????? 2- (2-aminoethyl) indole-5-ol 2-imino-1-methylimidazoline-4-one ??????? 2-?????-1-????-4-????-4?5-?? ?????-1H-?????????-1-ium 2- (5-????????-1H-?????-3-???) ??????????? ?????? (1:1:1)? 3- (2-aminoethyl) -1H-indol-5-ol? 2-?????-1-????-5H-?????????-4-??? ???? ????????? ??????
61-47-2 ???????? ???????? ?????? ??????????? ? 5-???????? ????????? ???????? ?????? ??????????? 2- (2-aminoethyl) indole-5-ol 2-imino-1-methylimidazoline-4-one ??????? 2-?????-1-????-4-????-4?5-?? ?????-1H-?????????-1-ium 2- (5-????????-1H-?????-3-???) ??????????? ?????? (1:1:1)? 3- (2-aminoethyl) -1H-indol-5-ol? 2-?????-1-????-5H-?????????-4-??? ???? ????????? ??????
| ??? ????? |
???????? ???????? ?????? ??????????? ? 5-???????? ????????? ???????? ?????? ??????????? 2- (2-aminoethyl) indole-5-ol 2-imino-1-methylimidazoline-4-one ??????? 2-?????-1-????-4-????-4?5-?? ?????-1H-?????????-1-ium 2- (5-????????-1H-?????-3-???) ??????????? ?????? (1:1:1)? 3- (2-aminoethyl) -1H-indol-5-ol? 2-?????-1-????-5H-?????????-4-??? ???? ????????? ?????? |
| ?????? |
2- (5-????????-1H-indol-3-yl) ???????????? |
| ??? ??????? |
Serotonin creatinine sulfate monohydrate; 5-Hydroxytryptamine creatinine sulfate monohydrate; 2-(2-aminoethyl)indole-5-ol 2-imino-1-methylimidazoline-4-one sulphate; 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazol-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminium sulfate (1:1:1); 3-(2-aminoethyl)-1H-indol-5-ol; 2-amino-1-methyl-5H-imidazol-4-one; sulfuric acid; hydrate; 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| ????? ???????? |
C10H13N2O |
| ??? ??????? |
177.2225 |
| InChI |
InChI=1/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| ????? ?????? |
61-47-2 |
| ????? ??????? ??????? |
213-539-3 |
| ?????? ??????? |
|
| ???? ??? |
216-219℃ |
| ???? ????? |
416.1°C at 760 mmHg |
| ???? ?????? |
205.4°C |
| ???? ???? |
1.63E-07mmHg at 25°C |
| ????? ??? |
R40:Possible risks of irreversible effects.;
|
| ??????? ????? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|