| ?????? ?? ??? |
?????????? |
| ????????? |
; 2,3,6-?????????????????????? ????; ?????????? [??????: ?????]; 2,3,6-?????; 2,3,6-??????????????????????? ????; 2,3,6-???????????????? ?????? ????; 2,3,6-????????????????????????; 2,3,6-???????????????????????? [?????]; 4-09-00-01681 (Beilstein ??????? ??????); ?????? ????, (2,3,6-????????????????) -; ?????? 2113332; ???????????? ????, 2,3,6-???????????-; ?????? ??.882; ?????????? 201-599-3; EPA ??????? ???????? ??? 082601; ?????; ????; ?????????; ???????? 3434; ???????; ???????? 2,3,6-??????????????????????; ???????? 2,3,6-?????????????????????? [???]; ?????? 41931; ???? ???; ????-???; ????????; (2,3,6-????????????????) ?????? |
| ???????? ??? |
Chlorfenac; 2,3,6-Trichlorophenylacetic acid; Chlorfenac [BSI:ISO]; 2,3,6-TCA; 2,3,6-Trichlorobenzeneacetic acid; 2,3,6-Trichlorophenyl acetic acid; 2,3,6-Trichlorphenylessigsaeure; 2,3,6-Trichlorphenylessigsaeure [German]; 4-09-00-01681 (Beilstein Handbook Reference); Acetic acid, (2,3,6-trichlorophenyl)-; BRN 2113332; Benzeneacetic acid, 2,3,6-trichloro-; Caswell No. 882; EINECS 201-599-3; EPA Pesticide Chemical Code 082601; Fenac; Fenae; Fenatrol; HSDB 3434; Kanepar; Kyselina 2,3,6-trichlorfenyloctova; Kyselina 2,3,6-trichlorfenyloctova [Czech]; NSC 41931; Tri fene; Tri-fen; Trifene; (2,3,6-trichlorophenyl)acetate |
| ????? ???????? |
C8H4Cl3O2 |
| ?????? ??? |
238.4757 |
| InChI |
InChI=1/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13)/p-1 |
| ??? ??????? ?????? |
85-34-7 |
| EINECS |
201-599-3 |
| ????? ?????? |
|
| ????? ?? ??? |
353.5°C at 760 mmHg |
| ????? ??????? |
167.6°C |
| ????? ?? ???? |
1.32E-05mmHg at 25°C |
| ???? ?? ??? |
R22:Harmful if swallowed.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| ??????? ????? |
S36:Wear suitable protective clothing.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|