ChemNet > CAS > 61-47-2 ????????? ?????????? ?????? ????????????
61-47-2 ????????? ?????????? ?????? ????????????
| ?????? ?? ??? |
????????? ?????????? ?????? ???????????? |
| ????????? |
; 5-??????????????????????? ?????????? ?????? ????????????; 2- (2-?????????) ?????-5-??? 2-?????-1-????????????????-4-?? ??????; 2-?????-1-??????-4-?????-4,5-??????????-1H-?????????-1-ium 2- (5-???????????-1H-?????-3-?????) ??????????? ?????? (1:1:1); 3- (2-?????????) -1 ??-????? -5-???; 2-?????-1-??????-5H-?????????-4-??; ?????????? ????; ????????; 2- (5-???????????-1H-?????-3-?????) ??????????? |
| ???????? ??? |
Serotonin creatinine sulfate monohydrate; 5-Hydroxytryptamine creatinine sulfate monohydrate; 2-(2-aminoethyl)indole-5-ol 2-imino-1-methylimidazoline-4-one sulphate; 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazol-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminium sulfate (1:1:1); 3-(2-aminoethyl)-1H-indol-5-ol; 2-amino-1-methyl-5H-imidazol-4-one; sulfuric acid; hydrate; 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| ????? ???????? |
C10H13N2O |
| ?????? ??? |
177.2225 |
| InChI |
InChI=1/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| ??? ??????? ?????? |
61-47-2 |
| EINECS |
213-539-3 |
| ????? ?????? |
|
| ?????? |
216-219℃ |
| ????? ?? ??? |
416.1°C at 760 mmHg |
| ????? ??????? |
205.4°C |
| ????? ?? ???? |
1.63E-07mmHg at 25°C |
| ???? ?? ??? |
R40:Possible risks of irreversible effects.;
|
| ??????? ????? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|