| ?? ????? |
??????? |
| ?????? |
; 2,3,6-????? ???????????? ?????; ??????? [BSI:ISO]; 2,3,6-TCA; 2,3,6-????? Trichlorobenzeneacetic; 2,3,6-????? ????? ????????????; 2,3,6-Trichlorphenylessigsaeure; 2,3,6-Trichlorphenylessigsaeure [??????]; 4-09-00-01681 (????? ?????? ????????); ????? ?????, (2,3,6-trichlorophenyl)-; BRN 2113332; ????? ??????, 2,3,6-????????-; ????? ??.882; EINECS 201-599-3; ??? ???? ?????? ????? ?? EPA 082601; ????; ???; ??????; HSDB 3434; ?????; Kyselina 2,3,6-trichlorfenyloctova; Kyselina 2,3,6-trichlorfenyloctova [?'???]; ??"? 41931; ??? ??; ???-??; ?????; (2,3,6-????????????)???? |
| ?? ????? |
Chlorfenac; 2,3,6-Trichlorophenylacetic acid; Chlorfenac [BSI:ISO]; 2,3,6-TCA; 2,3,6-Trichlorobenzeneacetic acid; 2,3,6-Trichlorophenyl acetic acid; 2,3,6-Trichlorphenylessigsaeure; 2,3,6-Trichlorphenylessigsaeure [German]; 4-09-00-01681 (Beilstein Handbook Reference); Acetic acid, (2,3,6-trichlorophenyl)-; BRN 2113332; Benzeneacetic acid, 2,3,6-trichloro-; Caswell No. 882; EINECS 201-599-3; EPA Pesticide Chemical Code 082601; Fenac; Fenae; Fenatrol; HSDB 3434; Kanepar; Kyselina 2,3,6-trichlorfenyloctova; Kyselina 2,3,6-trichlorfenyloctova [Czech]; NSC 41931; Tri fene; Tri-fen; Trifene; (2,3,6-trichlorophenyl)acetate |
| ????????? ??????? |
C8H4Cl3O2 |
| ???? ???????? |
238.4757 |
| InChI |
InChI=1/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13)/p-1 |
| ???? CAS |
85-34-7 |
| EINECS |
201-599-3 |
| ???? ???????? |
|
| ????? ????? |
353.5°C at 760 mmHg |
| ????? ???? |
167.6°C |
| ??? ???? |
1.32E-05mmHg at 25°C |
| ??????? ???? |
R22:Harmful if swallowed.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| ?????? ????? |
S36:Wear suitable protective clothing.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|