75-39-8 ????? ?????? ?????????
| ?? ????? |
????? ?????? ????????? |
| ?????? |
Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; ????? ?????? ?????????,; ?????????-??????; 1-??????????; ????????? ??????? (1:1) |
| ?? ????? |
Acetaldehyde ammonia trimer; Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| ????????? ??????? |
C2H7NO |
| ???? ???????? |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| ???? CAS |
75-39-8 |
| EINECS |
200-868-2 |
| ???? ???????? |
|
| ?????? |
0.967g/cm3 |
| ????? ????? |
95-97℃ |
| ????? ????? |
113.8°C at 760 mmHg |
| ???? ????? |
1.431 |
| ????? ???? |
22.7°C |
| ??? ???? |
10.4mmHg at 25°C |
| Hazard ?????? |
Xi:Irritant;
|
| ??????? ???? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|