813-56-9 Malonsav-d2 sav-d2
| termék neve |
Malonsav-d2 sav-d2 |
| Szinonimák |
; Malonsav-d4; (~2~H_2_)propán(~2~H_2_)dioinsav |
| Angol név |
Malonic-d2 acid-d2; Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
| MF |
C3D4O4 |
| Molekulat?meg |
108.0861 |
| InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| CAS-szám |
813-56-9 |
| EINECS |
212-385-4 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.605g/cm3 |
| Olvadáspont |
130-132℃ |
| Forráspont |
386.8°C at 760 mmHg |
| T?résmutató |
1.478 |
| Gyulladáspont |
201.9°C |
| G?znyomás |
4.66E-07mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|