ChemNet > CAS > 4265-57-0 Μεθυλενοδι?(3-θειοπροπιονικ? οξ?)
4265-57-0 Μεθυλενοδι?(3-θειοπροπιονικ? οξ?)
| Ονομασ?α του προ??ντο? |
Μεθυλενοδι?(3-θειοπροπιονικ? οξ?) |
| Συν?νυμα |
3,3'-(μεθυλενοδι?(θειο))δισπιονικ? οξ? |
| Αγγλικ? ?νομα |
Methylenebis(3-thiopropionic acid);3,3'-(Methylenebis(thio))bispropionic acid |
| MF |
C7H12O4S2 |
| Μοριακ? β?ρο? |
224.2978 |
| InChI |
InChI=1/C7H12O4S2/c8-6(9)4(2-12)1-5(3-13)7(10)11/h4-5,12-13H,1-3H2,(H,8,9)(H,10,11) |
| CAS ΟΧΙ |
4265-57-0 |
| EINECS |
224-251-2 |
| Μοριακ? δομ? |
|
| Δε?κτη? δι?θλαση? |
1.571 |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|