3404-61-3 3-μεθυλο-1-εξ?νιο
| Ονομασ?α του προ??ντο? |
3-μεθυλο-1-εξ?νιο |
| Συν?νυμα |
1-εξ?νιο, 3-μεθυλο-; 222-283-1; 3-μεθυλεξεξ-1-ενο. |
| Αγγλικ? ?νομα |
3-Methyl-1-hexene; 1-hexene, 3-methyl-; 222-283-1; 3-methylhex-1-ene |
| MF |
C7H14 |
| Μοριακ? β?ρο? |
98.1861 |
| InChI |
InChI=1/C7H14/c1-4-6-7(3)5-2/h5,7H,2,4,6H2,1,3H3 |
| CAS ΟΧΙ |
3404-61-3 |
| EINECS |
222-283-1 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.703g/cm3 |
| Σημε?ο βρασμο? |
85.4°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.404 |
| Π?εση ατμ?ν |
77.8mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
F:Highly flammable;
Xi:Irritant;
|
| Κινδ?νου Κ?δικε? |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|