96-29-7 Ethyl methyl ketone oxime
| product Name |
Ethyl methyl ketone oxime |
| CAS No |
96-29-7 |
| Synonyms |
2-Butanone oxime; 2-butoxime; aron m 1; butanone oxime; ethyl methyl ketoxime; Methyl ethyl ketoxime; (2E)-butan-2-one oxime; (2Z)-butan-2-one oxime; MEKO |
| Molecular Formula |
C4H9NO |
| Molecular Weight |
87.1204 |
| InChI |
InChI=1/C4H9NO/c1-3-4(2)5-6/h6H,3H2,1-2H3/b5-4- |
| EINECS |
202-496-6 |
| Molecular Structure |
|
| Density |
0.9g/cm3 |
| Melting point |
-30℃ |
| Boiling point |
152.5°C at 760 mmHg |
| Refractive index |
1.421 |
| Flash point |
60°C |
| Water solubility |
114 g/L (20℃) |
| Vapour Pressur |
1.88mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R21:;
R40:;
R41:;
R43:;
|
| Safety Description |
S13:;
S23:;
S26:;
S36/37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Packing |
upon clients' requests. |
| Description |
Molecular formula: CH3C(=NOH)CH2CH3 Chemical name: Anti-skinning agent KL-841, methylethylketoxime Application: Used for crust forming proof agent of oxidation drying coatings, viscosity stabilizer of oxidation drying adhesive, sealant of isocyanate and cross linker of organic silicon. Dosage: 0.1-0.5% of total weight of coatings, and the actual dosage is subject to coating formula and experimental effect. Package: upon clients' requests |
| Contact |
xu shuqun |
| Telephone |
86-570-3687818 3375533 |
| Email |
kailin1133@kailinchem.com |
| Address |
6 Nianhua Rd., Quzhou High-tech Industrial Park, Quzhou, Zhejiang, China. |
| Packing |
190kgs net iron drum(1x20'FCL=15.2mts with pallet) |
| Description |
Molecular Formula: C2H5C(=NOH)CH3CAS Number: 96-29-7Description: bp: 152?CDensity: 0.92 g/ml at 25?C (lit.)SpecificationAssay: 99.0% minMoisture: 0.04% maxAcid(as KOH): 0.05mg/g maxColour: 5hazen max |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Carolina |
| Telephone |
0086-756-332 9497 |
| Email |
E-carolina@zhgoldenchem.com |
| Address |
Rm,312,,3/F office Bldg.,Nanhai Oil Hotel, No.368,Road Shuiwan,Zhuhai China |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Freed Mao |
| Telephone |
+86-571-89936163 |
| Email |
ivytrade@vip.163.com |
| Address |
No. D, Floor 3, 508# Tianyuan Building, Wensan Rd.,Hangzhou, China |