688-71-1 Boron n-propoxide
| product Name |
Boron n-propoxide |
| CAS No |
688-71-1 |
| Synonyms |
Tripropyl borate; Boronnpropoxide; Boric acid tri-n-propyl ester; Tripropyl orthoborate; Tripropoxyborane; Propyl orthoborate; Boron propoxide; Propyl borate; boricacid(h3bo3),tripropylester; Boric acid (H3BO3), tripropyl ester |
| Molecular Formula |
C9H21BO3 |
| Molecular Weight |
188.0722 |
| InChI |
InChI=1/C9H21BO3/c1-4-7-11-10(12-8-5-2)13-9-6-3/h4-9H2,1-3H3 |
| EINECS |
211-703-9 |
| Molecular Structure |
|
| Density |
0.862g/cm3 |
| Boiling point |
181.7°C at 760 mmHg |
| Refractive index |
1.395 |
| Flash point |
32.2°C |
| Vapour Pressur |
1.15mmHg at 25°C |
|
Featured China Suppliers
| Contact |
peter |
| Telephone |
+86-21-38681880 |
| Email |
peter.xu@synmedia-chem.com |
| Address |
2/F, Block 3, East Area of Zhangjiang High Science and |