575-61-1 Benzalphthalide
| product Name |
Benzalphthalide |
| CAS No |
575-61-1 |
| Synonyms |
3-Benzylidenephthalide; Benzalphthalein; (3Z)-3-Benzylidene-2-benzofuran-1(3H)-one; 1(3H)-Isobenzofuranone, 3-(phenylmethylene)-; 3-(phenylmethylene)-1(3h)-isobenzofuranon; 3-benzylidene-phthalid; Benzalphthalid; benzylidenephthalide; escalol547; Phthalide, 3-benzylidene-; (3E)-3-benzylidene-2-benzofuran-1(3H)-one |
| Molecular Formula |
C15H10O2 |
| Molecular Weight |
222.2387 |
| InChI |
InChI=1/C15H10O2/c16-15-13-9-5-4-8-12(13)14(17-15)10-11-6-2-1-3-7-11/h1-10H/b14-10+ |
| EINECS |
209-388-8 |
| Molecular Structure |
|
| Density |
1.278g/cm3 |
| Melting point |
100-104℃ |
| Boiling point |
374.1°C at 760 mmHg |
| Refractive index |
1.686 |
| Flash point |
156.9°C |
| Vapour Pressur |
8.54E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Zhang Chao,Wei Guangling,Liu Jun |
| Telephone |
+86-21-62417129 62414096 |
| Email |
timzhang@pinewood-sales.com,irene.wei@pinewood-sales.com,june@huapaigroup.com |
| Address |
B Zuo 27F No.2 Lane 600 Tianshan Road, Shanghai |
| Contact |
Sergei Gresko |
| Telephone |
+380623854830 |
| Email |
sales@intermedchemicals.com |
| Address |
17-a Bakinsky Kommissarov Str. 83049 Donetsk UKRAINE |