513-86-0 Acetyl methyl carbinol
| product Name |
Acetyl methyl carbinol |
| CAS No |
513-86-0 |
| Synonyms |
3-Hydroxy-2-butanone; acetoin, mixture of monomer and dimer; Acetoin (3-Hydroxy-2-butanone); 1-acetylethanol; Acetoin; 3-hydroxybutan-2-one; (3R)-3-hydroxybutan-2-one; (3S)-3-hydroxybutan-2-one; Acetoion; Acetion |
| Molecular Formula |
C4H8O2 |
| Molecular Weight |
88.1051 |
| InChI |
InChI=1/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m0/s1 |
| EINECS |
208-174-1 |
| Molecular Structure |
|
| Density |
0.983g/cm3 |
| Melting point |
15℃ |
| Boiling point |
145.4°C at 760 mmHg |
| Refractive index |
1.408 |
| Flash point |
49.7°C |
| Water solubility |
SOLUBLE |
| Vapour Pressur |
1.92mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:;
R36/38:;
|
| Safety Description |
S26:;
S36/37:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
David Wang |
| Telephone |
David@ji-tian.com |
| Email |
David@ji-tian.com |
| Address |
Industrial Zone Longyang Town Tengzhou City,Shandong Province,CHINA |
| Contact |
Karl |
| Telephone |
+86-571-85395792 +13867466880 |
| Email |
info@orchid-chem.com |
| Address |
R1812, 607, North Zhongshan Road, Hangzhou, Zhejiang, China |
| Contact |
Xu Hongbin |
| Telephone |
+86-515-86111688;86221388;86098099 |
| Email |
sales@hongtaibiochem.com |
| Address |
271 Xiangyang West Road, Jianhu County, Jiangsu province |
| Telephone |
+86-573-4755178,4755179 |
| Email |
zhiyuan@hi2000.com |
| Address |
Jiashan Econornic Developing Zone,Jiaxing.Zhejiang.China |
| Contact |
Mr. Shen Yang |
| Telephone |
+86-573-82116167;2117026;2117720;2117233 |
| Email |
winsunchem@winsunchem.com |
| Address |
No.39 Kai Xi Road., Jiaxing, Zhejiang Province, PRC |