371-41-5 4-Fluorophenol
| product Name |
4-Fluorophenol |
| CAS No |
371-41-5 |
| Synonyms |
Fluorophenoloffwhiteflakes; p-fluorophenol; O-Fluorophenol |
| Molecular Formula |
C6H5FO |
| Molecular Weight |
112.1017 |
| InChI |
InChI=1/C6H5FO/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| EINECS |
206-736-0 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Melting point |
44-49℃ |
| Boiling point |
183.3°C at 760 mmHg |
| Refractive index |
1.523 |
| Flash point |
74.8°C |
| Water solubility |
50 g/L |
| Vapour Pressur |
0.569mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:;
R36/37/38:;
R52/53:;
|
| Safety Description |
S26:;
S37/39:;
S61:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-571-88383188;86970388;+49-211-550203-21 |
| Email |
sales@dragon-chem.com |
| Address |
16/Fl., Tower B, Qingchun Development Building, 66 East Qingchun Rd., Hangzhou, China |
| Contact |
Daisy Wang |
| Telephone |
+86-576-85588188,85588118,85588138 |
| Email |
daisy.wang@yongtaitech.com |
| Address |
Zhejiang Provincial Chemical and Medical Raw Material Base Linhai Zone, Taizhou, 317016 China |
| Contact |
Scarlett |
| Telephone |
+86-575-82399190;+86-13819637081 |
| Email |
sales06@xieshichem.com |
| Address |
No.16, Fine Chemical Park, Weiwu Road, Hangzhou Bay, Shanguu City, Zhejiang Province, China |
| Contact |
Zhu Lipin |
| Telephone |
+86-519-83299352 |
| Email |
liujh@hi2000.com |
| Address |
NO. 9 Xuansheng Bridge, Beside Old 312 National Road, Nanjiao,Changzhou City, China. |
| Telephone |
86-576-85689892 |
| Email |
sales@wonderfult.com |
| Address |
Economy development area Yongquan, Linhai City, Zhejiang P.R. of China |