2845-89-8 m-chloroanisole
| product Name |
m-chloroanisole |
| CAS No |
2845-89-8 |
| Synonyms |
1-Chloro-3-methoxybenzene; 3-Chloroanisole; 1-amino-2-phenylbutan-2-ol; 3-chloromethoxybenzene |
| Molecular Formula |
C7H7ClO |
| Molecular Weight |
142.5829 |
| InChI |
InChI=1/C7H7ClO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 |
| EINECS |
220-642-7 |
| Molecular Structure |
|
| Density |
1.137g/cm3 |
| Boiling point |
197.5°C at 760 mmHg |
| Refractive index |
1.515 |
| Flash point |
73.3°C |
| Vapour Pressur |
0.531mmHg at 25°C |
| Safety Description |
S23:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-571-88902504;88902507 |
| Email |
shoufu@shoufuchem.com |
| Address |
5/F, Yangfan Venture Plaza, 31 Xincheng Road, Binjiang District, Hangzhou City, Zhejiang Province, P.R.China |
| Contact |
Kong Lingzhi;Wang qiang |
| Telephone |
+86-25-84651981 |
| Email |
sales@nastchem.com |
| Address |
Building 15-D,Rongchuang Scientific Research Center,No.99 Lize Road,Jiangning,Nanjing,China |
| Specifications |
99.9% |
| Packing |
250g |
| Description |
Replace the Chloroanisole to product Tramadol,as the intermediates |
| Contact |
Mr.Josh |
| Telephone |
+86-21-35110531 |
| Email |
sh@demchem.com |
| Address |
Room 3H, No.578, Yingkou Road, Yangpu District, Shanghai, China |